C9H16NO3- — CID 101141232
(2R)-2-cyano-3,3-diethoxybutan-2-olate (PubChem CID 101141232) has the molecular formula C9H16NO3- and a molecular weight of 186.23 g/mol. Its IUPAC name is (2R)-2-cyano-3,3-diethoxybutan-2-olate.
| Compound Name | (2R)-2-cyano-3,3-diethoxybutan-2-olate |
|---|---|
| PubChem CID | 101141232 |
| Molecular Formula | C9H16NO3- |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (2R)-2-cyano-3,3-diethoxybutan-2-olate |
| SMILES | CCOC(C)(OCC)[C@](C)([O-])C#N |
| InChI | InChI=1S/C9H16NO3/c1-5-12-9(4,13-6-2)8(3,11)7-10/h5-6H2,1-4H3/q-1/t8-/m1/s1 |
| InChIKey | PWFSPWHDBAFARX-MRVPVSSYSA-N |
| XLogP | 0.42 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|