C9H22O3SSi — CID 173082949
1,2,2-triethoxy-1-silylpropane-1-thiol (PubChem CID 173082949) has the molecular formula C9H22O3SSi and a molecular weight of 238.42 g/mol. Its IUPAC name is 1,2,2-triethoxy-1-silylpropane-1-thiol.
| Compound Name | 1,2,2-triethoxy-1-silylpropane-1-thiol |
|---|---|
| PubChem CID | 173082949 |
| Molecular Formula | C9H22O3SSi |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1,2,2-triethoxy-1-silylpropane-1-thiol |
| SMILES | CCOC([SiH3])(S)C(C)(OCC)OCC |
| InChI | InChI=1S/C9H22O3SSi/c1-5-10-8(4,11-6-2)9(13,14)12-7-3/h13H,5-7H2,1-4,14H3 |
| InChIKey | FXJBKZOZQAAYPT-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|