C13H30OSi — CID 123938104
(4-ethoxy-2,2,6,6-tetramethylheptan-4-yl)silane (PubChem CID 123938104) has the molecular formula C13H30OSi and a molecular weight of 230.47 g/mol. Its IUPAC name is (4-ethoxy-2,2,6,6-tetramethylheptan-4-yl)silane.
| Compound Name | (4-ethoxy-2,2,6,6-tetramethylheptan-4-yl)silane |
|---|---|
| PubChem CID | 123938104 |
| Molecular Formula | C13H30OSi |
| Molecular Weight | 230.47 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | (4-ethoxy-2,2,6,6-tetramethylheptan-4-yl)silane |
| SMILES | CCOC([SiH3])(CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C13H30OSi/c1-8-14-13(15,9-11(2,3)4)10-12(5,6)7/h8-10H2,1-7,15H3 |
| InChIKey | FIXGKDSWPZPAPG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|