C10H24O4Si — CID 173335290
1,1-diethoxyethyl(diethoxy)silane (PubChem CID 173335290) has the molecular formula C10H24O4Si and a molecular weight of 236.38 g/mol. Its IUPAC name is 1,1-diethoxyethyl(diethoxy)silane.
| Compound Name | 1,1-diethoxyethyl(diethoxy)silane |
|---|---|
| PubChem CID | 173335290 |
| Molecular Formula | C10H24O4Si |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1,1-diethoxyethyl(diethoxy)silane |
| SMILES | CCO[SiH](OCC)C(C)(OCC)OCC |
| InChI | InChI=1S/C10H24O4Si/c1-6-11-10(5,12-7-2)15(13-8-3)14-9-4/h15H,6-9H2,1-5H3 |
| InChIKey | ZCUNIMBHARRWQT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|