C74H84N2O4 — CID 101142380
tris(4-tert-butylphenyl)methyl 6-[5-[tris(4-tert-butylphenyl)methoxycarbonyl]-2-pyridinyl]pyridine-3-carboxylate (PubChem CID 101142380) has the molecular formula C74H84N2O4 and a molecular weight of 1065.50 g/mol. Its IUPAC name is tris(4-tert-butylphenyl)methyl 6-[5-[tris(4-tert-butylphenyl)methoxycarbonyl]-2-pyridinyl]pyridine-3-carboxylate.
| Compound Name | tris(4-tert-butylphenyl)methyl 6-[5-[tris(4-tert-butylphenyl)methoxycarbonyl]-2-pyridinyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 101142380 |
| Molecular Formula | C74H84N2O4 |
| Molecular Weight | 1065.50 g/mol |
| Exact Mass | 1064.64 |
| IUPAC Name | tris(4-tert-butylphenyl)methyl 6-[5-[tris(4-tert-butylphenyl)methoxycarbonyl]-2-pyridinyl]pyridine-3-carboxylate |
| SMILES | CC(C)(C)c1ccc(C(OC(=O)c2ccc(-c3ccc(C(=O)OC(c4ccc(C(C)(C)C)cc4)(c4ccc(C(C)(C)C)cc4)c4ccc(C(C)(C)C)cc4)cn3)nc2)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C74H84N2O4/c1-67(2,3)51-21-33-57(34-22-51)73(58-35-23-52(24-36-58)68(4,5)6,59-37-25-53(26-38-59)69(7,8)9)79-65(77)49-19-45-63(75-47-49)64-46-20-50(48-76-64)66(78)80-74(60-39-27-54(28-40-60)70(10,11)12,61-41-29-55(30-42-61)71(13,14)15)62-43-31-56(32-44-62)72(16,17)18/h19-48H,1-18H3 |
| InChIKey | VFEUOJTVEBKFSR-UHFFFAOYSA-N |
| XLogP | 18.23 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.50 |
| LogP ≤ 5 | 18.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|