C19H20O4S — CID 101142433
(1R,4S)-2-(benzenesulfonyl)-4-(2-methoxyphenyl)cyclohex-2-en-1-ol (PubChem CID 101142433) has the molecular formula C19H20O4S and a molecular weight of 344.43 g/mol. Its IUPAC name is (1R,4S)-2-(benzenesulfonyl)-4-(2-methoxyphenyl)cyclohex-2-en-1-ol.
| Compound Name | (1R,4S)-2-(benzenesulfonyl)-4-(2-methoxyphenyl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 101142433 |
| Molecular Formula | C19H20O4S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (1R,4S)-2-(benzenesulfonyl)-4-(2-methoxyphenyl)cyclohex-2-en-1-ol |
| SMILES | COc1ccccc1[C@@H]1C=C(S(=O)(=O)c2ccccc2)[C@H](O)CC1 |
| InChI | InChI=1S/C19H20O4S/c1-23-18-10-6-5-9-16(18)14-11-12-17(20)19(13-14)24(21,22)15-7-3-2-4-8-15/h2-10,13-14,17,20H,11-12H2,1H3/t14-,17+/m0/s1 |
| InChIKey | PTOUXPJNPCLHSJ-WMLDXEAASA-N |
| XLogP | 3.29 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |