C12H13FO3S — CID 11807281
(1R,4R)-2-(benzenesulfonyl)-4-fluorocyclohex-2-en-1-ol (PubChem CID 11807281) has the molecular formula C12H13FO3S and a molecular weight of 256.30 g/mol. Its IUPAC name is (1R,4R)-2-(benzenesulfonyl)-4-fluorocyclohex-2-en-1-ol.
| Compound Name | (1R,4R)-2-(benzenesulfonyl)-4-fluorocyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 11807281 |
| Molecular Formula | C12H13FO3S |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | (1R,4R)-2-(benzenesulfonyl)-4-fluorocyclohex-2-en-1-ol |
| SMILES | O=S(=O)(C1=C[C@H](F)CC[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C12H13FO3S/c13-9-6-7-11(14)12(8-9)17(15,16)10-4-2-1-3-5-10/h1-5,8-9,11,14H,6-7H2/t9-,11-/m1/s1 |
| InChIKey | IVMGSLURUISWSJ-MWLCHTKSSA-N |
| XLogP | 1.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |