C23H16F3NO3S — CID 10114329
3-(5-acetylthiophen-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid (PubChem CID 10114329) has the molecular formula C23H16F3NO3S and a molecular weight of 443.45 g/mol. Its IUPAC name is 3-(5-acetylthiophen-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid.
| Compound Name | 3-(5-acetylthiophen-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 10114329 |
| Molecular Formula | C23H16F3NO3S |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 3-(5-acetylthiophen-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid |
| SMILES | CC(=O)c1ccc(-c2c(C(=O)O)n(Cc3cccc(C(F)(F)F)c3)c3ccccc23)s1 |
| InChI | InChI=1S/C23H16F3NO3S/c1-13(28)18-9-10-19(31-18)20-16-7-2-3-8-17(16)27(21(20)22(29)30)12-14-5-4-6-15(11-14)23(24,25)26/h2-11H,12H2,1H3,(H,29,30) |
| InChIKey | NCBYLAVRIDKLQY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |