C24H24FN7O — CID 10114464
5-(3-aminopropoxymethyl)-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 10114464) has the molecular formula C24H24FN7O and a molecular weight of 445.50 g/mol. Its IUPAC name is 5-(3-aminopropoxymethyl)-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-(3-aminopropoxymethyl)-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 10114464 |
| Molecular Formula | C24H24FN7O |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 5-(3-aminopropoxymethyl)-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | NCCCOCc1ccn2ncnc(Nc3ccc4c(cnn4Cc4cccc(F)c4)c3)c12 |
| InChI | InChI=1S/C24H24FN7O/c25-20-4-1-3-17(11-20)14-32-22-6-5-21(12-19(22)13-28-32)30-24-23-18(15-33-10-2-8-26)7-9-31(23)29-16-27-24/h1,3-7,9,11-13,16H,2,8,10,14-15,26H2,(H,27,29,30) |
| InChIKey | IGODIYJKZLOCRX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|