C17H25NO4 — CID 101144705
4-[(3,3-dimethyloxiran-2-yl)methyl]-N,N-diethyl-3-hydroxy-5-methoxybenzamide (PubChem CID 101144705) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-[(3,3-dimethyloxiran-2-yl)methyl]-N,N-diethyl-3-hydroxy-5-methoxybenzamide.
| Compound Name | 4-[(3,3-dimethyloxiran-2-yl)methyl]-N,N-diethyl-3-hydroxy-5-methoxybenzamide |
|---|---|
| PubChem CID | 101144705 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-[(3,3-dimethyloxiran-2-yl)methyl]-N,N-diethyl-3-hydroxy-5-methoxybenzamide |
| SMILES | CCN(CC)C(=O)c1cc(O)c(CC2OC2(C)C)c(OC)c1 |
| InChI | InChI=1S/C17H25NO4/c1-6-18(7-2)16(20)11-8-13(19)12(14(9-11)21-5)10-15-17(3,4)22-15/h8-9,15,19H,6-7,10H2,1-5H3 |
| InChIKey | SMIKFYQHBRUQOF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|