C24H32O2 — CID 101145268
(3R,6S)-6-[(R)-methoxy(phenyl)methyl]-2-methyl-5-methylidene-8-phenyloctan-3-ol (PubChem CID 101145268) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is (3R,6S)-6-[(R)-methoxy(phenyl)methyl]-2-methyl-5-methylidene-8-phenyloctan-3-ol.
| Compound Name | (3R,6S)-6-[(R)-methoxy(phenyl)methyl]-2-methyl-5-methylidene-8-phenyloctan-3-ol |
|---|---|
| PubChem CID | 101145268 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (3R,6S)-6-[(R)-methoxy(phenyl)methyl]-2-methyl-5-methylidene-8-phenyloctan-3-ol |
| SMILES | C=C(C[C@@H](O)C(C)C)[C@H](CCc1ccccc1)[C@@H](OC)c1ccccc1 |
| InChI | InChI=1S/C24H32O2/c1-18(2)23(25)17-19(3)22(16-15-20-11-7-5-8-12-20)24(26-4)21-13-9-6-10-14-21/h5-14,18,22-25H,3,15-17H2,1-2,4H3/t22-,23+,24-/m0/s1 |
| InChIKey | RBPIHESWORECIT-VXNXHJTFSA-N |
| XLogP | 5.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|