C18H23NO5 — CID 101145772
(1R,2S,5S,6R,9S,10R,14R)-3,12,12-trimethyl-5-phenyl-4,8,11,13,15-pentaoxa-3-azatetracyclo[7.6.0.02,6.010,14]pentadecane (PubChem CID 101145772) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is (1R,2S,5S,6R,9S,10R,14R)-3,12,12-trimethyl-5-phenyl-4,8,11,13,15-pentaoxa-3-azatetracyclo[7.6.0.02,6.010,14]pentadecane.
| Compound Name | (1R,2S,5S,6R,9S,10R,14R)-3,12,12-trimethyl-5-phenyl-4,8,11,13,15-pentaoxa-3-azatetracyclo[7.6.0.02,6.010,14]pentadecane |
|---|---|
| PubChem CID | 101145772 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (1R,2S,5S,6R,9S,10R,14R)-3,12,12-trimethyl-5-phenyl-4,8,11,13,15-pentaoxa-3-azatetracyclo[7.6.0.02,6.010,14]pentadecane |
| SMILES | CN1O[C@H](c2ccccc2)[C@H]2CO[C@@H]3[C@H]4OC(C)(C)O[C@H]4O[C@@H]3[C@H]21 |
| InChI | InChI=1S/C18H23NO5/c1-18(2)22-16-15-14(21-17(16)23-18)12-11(9-20-15)13(24-19(12)3)10-7-5-4-6-8-10/h4-8,11-17H,9H2,1-3H3/t11-,12-,13+,14+,15-,16+,17+/m0/s1 |
| InChIKey | OAWORFAFTUDORZ-QURQKCQSSA-N |
| XLogP | 1.86 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |