C9H18OSi — CID 101146882
(1S,2S)-2-(trimethylsilylmethyl)cyclopent-3-en-1-ol (PubChem CID 101146882) has the molecular formula C9H18OSi and a molecular weight of 170.33 g/mol. Its IUPAC name is (1S,2S)-2-(trimethylsilylmethyl)cyclopent-3-en-1-ol.
| Compound Name | (1S,2S)-2-(trimethylsilylmethyl)cyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 101146882 |
| Molecular Formula | C9H18OSi |
| Molecular Weight | 170.33 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (1S,2S)-2-(trimethylsilylmethyl)cyclopent-3-en-1-ol |
| SMILES | C[Si](C)(C)C[C@H]1C=CC[C@@H]1O |
| InChI | InChI=1S/C9H18OSi/c1-11(2,3)7-8-5-4-6-9(8)10/h4-5,8-10H,6-7H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | JISYLYXLCQTGNP-BDAKNGLRSA-N |
| XLogP | 2.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|