C6H11NO — CID 5256089
6-methyl-1,2,3,6-tetrahydropyridin-2-ol (PubChem CID 5256089) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is 6-methyl-1,2,3,6-tetrahydropyridin-2-ol.
| Compound Name | 6-methyl-1,2,3,6-tetrahydropyridin-2-ol |
|---|---|
| PubChem CID | 5256089 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 6-methyl-1,2,3,6-tetrahydropyridin-2-ol |
| SMILES | CC1C=CCC(O)N1 |
| InChI | InChI=1S/C6H11NO/c1-5-3-2-4-6(8)7-5/h2-3,5-8H,4H2,1H3 |
| InChIKey | PZRWPXKCLCJYQV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|