C35H48O7Si — CID 101151501
[(2S,3R,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl] (1S,2S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 101151501) has the molecular formula C35H48O7Si and a molecular weight of 608.85 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl] (1S,2S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [(2S,3R,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl] (1S,2S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 101151501 |
| Molecular Formula | C35H48O7Si |
| Molecular Weight | 608.85 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl] (1S,2S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CO[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(=O)[C@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C35H48O7Si/c1-35(2,3)43(5,6)42-31-30(39-22-25-15-11-8-12-16-25)29(23-38-21-24-13-9-7-10-14-24)40-34(37-4)32(31)41-33(36)28-20-26-17-18-27(28)19-26/h7-18,26-32,34H,19-23H2,1-6H3/t26-,27+,28-,29+,30+,31-,32+,34-/m0/s1 |
| InChIKey | XGXXWSJCWSMEFQ-IEUOGLJTSA-N |
| XLogP | 6.67 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.85 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|