C22H21Cl2NO4 — CID 101151776
ethyl (2Z)-2-[(5R)-7-chloro-5-(2-chlorophenyl)-2-oxo-1-propan-2-yl-5H-4,1-benzoxazepin-3-ylidene]acetate (PubChem CID 101151776) has the molecular formula C22H21Cl2NO4 and a molecular weight of 434.32 g/mol. Its IUPAC name is ethyl (2Z)-2-[(5R)-7-chloro-5-(2-chlorophenyl)-2-oxo-1-propan-2-yl-5H-4,1-benzoxazepin-3-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(5R)-7-chloro-5-(2-chlorophenyl)-2-oxo-1-propan-2-yl-5H-4,1-benzoxazepin-3-ylidene]acetate |
|---|---|
| PubChem CID | 101151776 |
| Molecular Formula | C22H21Cl2NO4 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | ethyl (2Z)-2-[(5R)-7-chloro-5-(2-chlorophenyl)-2-oxo-1-propan-2-yl-5H-4,1-benzoxazepin-3-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\O[C@@H](c2ccccc2Cl)c2cc(Cl)ccc2N(C(C)C)C1=O |
| InChI | InChI=1S/C22H21Cl2NO4/c1-4-28-20(26)12-19-22(27)25(13(2)3)18-10-9-14(23)11-16(18)21(29-19)15-7-5-6-8-17(15)24/h5-13,21H,4H2,1-3H3/b19-12-/t21-/m0/s1 |
| InChIKey | LDXFUVFRCWXTAC-JCAJYURWSA-N |
| XLogP | 5.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|