C20H19Cl2NO3 — CID 57219566
2-[7-chloro-5-(2-chlorophenyl)-2-oxo-1-propyl-5H-4,1-benzoxazepin-3-yl]acetaldehyde (PubChem CID 57219566) has the molecular formula C20H19Cl2NO3 and a molecular weight of 392.28 g/mol. Its IUPAC name is 2-[7-chloro-5-(2-chlorophenyl)-2-oxo-1-propyl-5H-4,1-benzoxazepin-3-yl]acetaldehyde.
| Compound Name | 2-[7-chloro-5-(2-chlorophenyl)-2-oxo-1-propyl-5H-4,1-benzoxazepin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 57219566 |
| Molecular Formula | C20H19Cl2NO3 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-[7-chloro-5-(2-chlorophenyl)-2-oxo-1-propyl-5H-4,1-benzoxazepin-3-yl]acetaldehyde |
| SMILES | CCCN1C(=O)C(CC=O)OC(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H19Cl2NO3/c1-2-10-23-17-8-7-13(21)12-15(17)19(14-5-3-4-6-16(14)22)26-18(9-11-24)20(23)25/h3-8,11-12,18-19H,2,9-10H2,1H3 |
| InChIKey | HQLSPJHDUGGONF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|