C21H28Si — CID 101151962
tert-butyl-[(Z)-2,3-diphenylprop-1-enyl]-dimethylsilane (PubChem CID 101151962) has the molecular formula C21H28Si and a molecular weight of 308.54 g/mol. Its IUPAC name is tert-butyl-[(Z)-2,3-diphenylprop-1-enyl]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-2,3-diphenylprop-1-enyl]-dimethylsilane |
|---|---|
| PubChem CID | 101151962 |
| Molecular Formula | C21H28Si |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | tert-butyl-[(Z)-2,3-diphenylprop-1-enyl]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)/C=C(/Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28Si/c1-21(2,3)22(4,5)17-20(19-14-10-7-11-15-19)16-18-12-8-6-9-13-18/h6-15,17H,16H2,1-5H3/b20-17- |
| InChIKey | FDEJCNDKRWOESL-JZJYNLBNSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|