C24H35NOSi — CID 102280219
(Z)-4-[ditert-butyl(hydroxy)silyl]-1,3-diphenylbut-3-en-2-amine (PubChem CID 102280219) has the molecular formula C24H35NOSi and a molecular weight of 381.64 g/mol. Its IUPAC name is (Z)-4-[ditert-butyl(hydroxy)silyl]-1,3-diphenylbut-3-en-2-amine.
| Compound Name | (Z)-4-[ditert-butyl(hydroxy)silyl]-1,3-diphenylbut-3-en-2-amine |
|---|---|
| PubChem CID | 102280219 |
| Molecular Formula | C24H35NOSi |
| Molecular Weight | 381.64 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | (Z)-4-[ditert-butyl(hydroxy)silyl]-1,3-diphenylbut-3-en-2-amine |
| SMILES | CC(C)(C)[Si](O)(/C=C(/c1ccccc1)C(N)Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H35NOSi/c1-23(2,3)27(26,24(4,5)6)18-21(20-15-11-8-12-16-20)22(25)17-19-13-9-7-10-14-19/h7-16,18,22,26H,17,25H2,1-6H3/b21-18- |
| InChIKey | WHTKMPCNCBNVKP-UZYVYHOESA-N |
| XLogP | 5.72 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.64 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|