C18H22O2 — CID 101152307
[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 4-methylbenzoate (PubChem CID 101152307) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 4-methylbenzoate.
| Compound Name | [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 101152307 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 4-methylbenzoate |
| SMILES | C=C(C)[C@@H]1CC=C(COC(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C18H22O2/c1-13(2)16-10-6-15(7-11-16)12-20-18(19)17-8-4-14(3)5-9-17/h4-6,8-9,16H,1,7,10-12H2,2-3H3/t16-/m1/s1 |
| InChIKey | YKMZEJFIMQTSRN-MRXNPFEDSA-N |
| XLogP | 4.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|