C10H16O3S — CID 118596934
(4-prop-1-en-2-ylcyclohexen-1-yl)methanesulfonic acid (PubChem CID 118596934) has the molecular formula C10H16O3S and a molecular weight of 216.30 g/mol. Its IUPAC name is (4-prop-1-en-2-ylcyclohexen-1-yl)methanesulfonic acid.
| Compound Name | (4-prop-1-en-2-ylcyclohexen-1-yl)methanesulfonic acid |
|---|---|
| PubChem CID | 118596934 |
| Molecular Formula | C10H16O3S |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (4-prop-1-en-2-ylcyclohexen-1-yl)methanesulfonic acid |
| SMILES | C=C(C)C1CC=C(CS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C10H16O3S/c1-8(2)10-5-3-9(4-6-10)7-14(11,12)13/h3,10H,1,4-7H2,2H3,(H,11,12,13) |
| InChIKey | SHGFAFMPHYLZFI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|