C16H30N2+2 — CID 6942999
1-ethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]piperazine-1,4-diium (PubChem CID 6942999) has the molecular formula C16H30N2+2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 1-ethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]piperazine-1,4-diium.
| Compound Name | 1-ethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 6942999 |
| Molecular Formula | C16H30N2+2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 1-ethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]piperazine-1,4-diium |
| SMILES | C=C(C)[C@@H]1CC=C(C[NH+]2CC[NH+](CC)CC2)CC1 |
| InChI | InChI=1S/C16H28N2/c1-4-17-9-11-18(12-10-17)13-15-5-7-16(8-6-15)14(2)3/h5,16H,2,4,6-13H2,1,3H3/p+2/t16-/m1/s1 |
| InChIKey | KOOXMLAKMQBXGW-MRXNPFEDSA-P |
| XLogP | 0.09 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|