C17H34O5S2Si — CID 101152614
methyl (3R,5R)-6-(1,3-dithian-2-yl)-3-hydroxy-5-(2-trimethylsilylethoxymethoxy)hexanoate (PubChem CID 101152614) has the molecular formula C17H34O5S2Si and a molecular weight of 410.67 g/mol. Its IUPAC name is methyl (3R,5R)-6-(1,3-dithian-2-yl)-3-hydroxy-5-(2-trimethylsilylethoxymethoxy)hexanoate.
| Compound Name | methyl (3R,5R)-6-(1,3-dithian-2-yl)-3-hydroxy-5-(2-trimethylsilylethoxymethoxy)hexanoate |
|---|---|
| PubChem CID | 101152614 |
| Molecular Formula | C17H34O5S2Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | methyl (3R,5R)-6-(1,3-dithian-2-yl)-3-hydroxy-5-(2-trimethylsilylethoxymethoxy)hexanoate |
| SMILES | COC(=O)C[C@H](O)C[C@H](CC1SCCCS1)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C17H34O5S2Si/c1-20-16(19)11-14(18)10-15(12-17-23-7-5-8-24-17)22-13-21-6-9-25(2,3)4/h14-15,17-18H,5-13H2,1-4H3/t14-,15-/m1/s1 |
| InChIKey | YCQGGUBTPJHRQL-HUUCEWRRSA-N |
| XLogP | 3.58 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|