C11H20O4S2 — CID 11380479
methyl (3R,5R)-6-(1,3-dithian-2-yl)-3,5-dihydroxyhexanoate (PubChem CID 11380479) has the molecular formula C11H20O4S2 and a molecular weight of 280.41 g/mol. Its IUPAC name is methyl (3R,5R)-6-(1,3-dithian-2-yl)-3,5-dihydroxyhexanoate.
| Compound Name | methyl (3R,5R)-6-(1,3-dithian-2-yl)-3,5-dihydroxyhexanoate |
|---|---|
| PubChem CID | 11380479 |
| Molecular Formula | C11H20O4S2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | methyl (3R,5R)-6-(1,3-dithian-2-yl)-3,5-dihydroxyhexanoate |
| SMILES | COC(=O)C[C@H](O)C[C@@H](O)CC1SCCCS1 |
| InChI | InChI=1S/C11H20O4S2/c1-15-10(14)6-8(12)5-9(13)7-11-16-3-2-4-17-11/h8-9,11-13H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | POHRFQOHJJMKKX-RKDXNWHRSA-N |
| XLogP | 1.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |