C14H28O4S2 — CID 134878913
tert-butyl (3S)-6,6-bis(ethylsulfanyl)-3,5-dihydroxyhexanoate (PubChem CID 134878913) has the molecular formula C14H28O4S2 and a molecular weight of 324.51 g/mol. Its IUPAC name is tert-butyl (3S)-6,6-bis(ethylsulfanyl)-3,5-dihydroxyhexanoate.
| Compound Name | tert-butyl (3S)-6,6-bis(ethylsulfanyl)-3,5-dihydroxyhexanoate |
|---|---|
| PubChem CID | 134878913 |
| Molecular Formula | C14H28O4S2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | tert-butyl (3S)-6,6-bis(ethylsulfanyl)-3,5-dihydroxyhexanoate |
| SMILES | CCSC(SCC)C(O)C[C@H](O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28O4S2/c1-6-19-13(20-7-2)11(16)8-10(15)9-12(17)18-14(3,4)5/h10-11,13,15-16H,6-9H2,1-5H3/t10-,11?/m0/s1 |
| InChIKey | VTPMOETUOCLWDV-VUWPPUDQSA-N |
| XLogP | 2.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|