C11H20O4S — CID 102304743
ethyl (4S,5R)-4-ethylsulfanylcarbonyl-5-hydroxyhexanoate (PubChem CID 102304743) has the molecular formula C11H20O4S and a molecular weight of 248.34 g/mol. Its IUPAC name is ethyl (4S,5R)-4-ethylsulfanylcarbonyl-5-hydroxyhexanoate.
| Compound Name | ethyl (4S,5R)-4-ethylsulfanylcarbonyl-5-hydroxyhexanoate |
|---|---|
| PubChem CID | 102304743 |
| Molecular Formula | C11H20O4S |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | ethyl (4S,5R)-4-ethylsulfanylcarbonyl-5-hydroxyhexanoate |
| SMILES | CCOC(=O)CC[C@H](C(=O)SCC)[C@@H](C)O |
| InChI | InChI=1S/C11H20O4S/c1-4-15-10(13)7-6-9(8(3)12)11(14)16-5-2/h8-9,12H,4-7H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | JOHNERKKHWKVIV-BDAKNGLRSA-N |
| XLogP | 1.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|