C14H26O4S — CID 10613484
ethyl (4S,5R)-4-ethylsulfanylcarbonyl-5-hydroxy-7-methyloctanoate (PubChem CID 10613484) has the molecular formula C14H26O4S and a molecular weight of 290.43 g/mol. Its IUPAC name is ethyl (4S,5R)-4-ethylsulfanylcarbonyl-5-hydroxy-7-methyloctanoate.
| Compound Name | ethyl (4S,5R)-4-ethylsulfanylcarbonyl-5-hydroxy-7-methyloctanoate |
|---|---|
| PubChem CID | 10613484 |
| Molecular Formula | C14H26O4S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | ethyl (4S,5R)-4-ethylsulfanylcarbonyl-5-hydroxy-7-methyloctanoate |
| SMILES | CCOC(=O)CC[C@H](C(=O)SCC)[C@H](O)CC(C)C |
| InChI | InChI=1S/C14H26O4S/c1-5-18-13(16)8-7-11(14(17)19-6-2)12(15)9-10(3)4/h10-12,15H,5-9H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | ICWXDAKORCJICD-NWDGAFQWSA-N |
| XLogP | 2.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|