C17H32O4S — CID 170077702
butyl 3-(6-ethyl-3-hydroxy-7-oxooctyl)sulfanylpropanoate (PubChem CID 170077702) has the molecular formula C17H32O4S and a molecular weight of 332.51 g/mol. Its IUPAC name is butyl 3-(6-ethyl-3-hydroxy-7-oxooctyl)sulfanylpropanoate.
| Compound Name | butyl 3-(6-ethyl-3-hydroxy-7-oxooctyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 170077702 |
| Molecular Formula | C17H32O4S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | butyl 3-(6-ethyl-3-hydroxy-7-oxooctyl)sulfanylpropanoate |
| SMILES | CCCCOC(=O)CCSCCC(O)CCC(CC)C(C)=O |
| InChI | InChI=1S/C17H32O4S/c1-4-6-11-21-17(20)10-13-22-12-9-16(19)8-7-15(5-2)14(3)18/h15-16,19H,4-13H2,1-3H3 |
| InChIKey | BTRVFPVOEMNLPD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|