C9H16O3S — CID 159953153
(3R)-3-[(2S,3S)-2-methyl-1,4-oxathian-3-yl]butanoic acid (PubChem CID 159953153) has the molecular formula C9H16O3S and a molecular weight of 204.29 g/mol. Its IUPAC name is (3R)-3-[(2S,3S)-2-methyl-1,4-oxathian-3-yl]butanoic acid.
| Compound Name | (3R)-3-[(2S,3S)-2-methyl-1,4-oxathian-3-yl]butanoic acid |
|---|---|
| PubChem CID | 159953153 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (3R)-3-[(2S,3S)-2-methyl-1,4-oxathian-3-yl]butanoic acid |
| SMILES | C[C@H](CC(=O)O)[C@@H]1SCCO[C@H]1C |
| InChI | InChI=1S/C9H16O3S/c1-6(5-8(10)11)9-7(2)12-3-4-13-9/h6-7,9H,3-5H2,1-2H3,(H,10,11)/t6-,7+,9+/m1/s1 |
| InChIKey | OCJIASCHDUXZRS-FJXKBIBVSA-N |
| XLogP | 1.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |