C13H24O3S2 — CID 135070078
tert-butyl (5R)-5-(1,3-dithian-2-yl)-5-hydroxypentanoate (PubChem CID 135070078) has the molecular formula C13H24O3S2 and a molecular weight of 292.47 g/mol. Its IUPAC name is tert-butyl (5R)-5-(1,3-dithian-2-yl)-5-hydroxypentanoate.
| Compound Name | tert-butyl (5R)-5-(1,3-dithian-2-yl)-5-hydroxypentanoate |
|---|---|
| PubChem CID | 135070078 |
| Molecular Formula | C13H24O3S2 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | tert-butyl (5R)-5-(1,3-dithian-2-yl)-5-hydroxypentanoate |
| SMILES | CC(C)(C)OC(=O)CCC[C@@H](O)C1SCCCS1 |
| InChI | InChI=1S/C13H24O3S2/c1-13(2,3)16-11(15)7-4-6-10(14)12-17-8-5-9-18-12/h10,12,14H,4-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | GCNYFHPPACJPJO-SNVBAGLBSA-N |
| XLogP | 3.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |