C15H26O4S2 — CID 135076391
tert-butyl 5-acetyloxy-5-(1,3-dithian-2-yl)pentanoate (PubChem CID 135076391) has the molecular formula C15H26O4S2 and a molecular weight of 334.50 g/mol. Its IUPAC name is tert-butyl 5-acetyloxy-5-(1,3-dithian-2-yl)pentanoate.
| Compound Name | tert-butyl 5-acetyloxy-5-(1,3-dithian-2-yl)pentanoate |
|---|---|
| PubChem CID | 135076391 |
| Molecular Formula | C15H26O4S2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | tert-butyl 5-acetyloxy-5-(1,3-dithian-2-yl)pentanoate |
| SMILES | CC(=O)OC(CCCC(=O)OC(C)(C)C)C1SCCCS1 |
| InChI | InChI=1S/C15H26O4S2/c1-11(16)18-12(14-20-9-6-10-21-14)7-5-8-13(17)19-15(2,3)4/h12,14H,5-10H2,1-4H3 |
| InChIKey | KPTGUHVYYNDLSC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |