C13H20O6S2 — CID 102245028
methyl (2S)-2-acetyloxy-3-[2-(2-methoxy-2-oxoethyl)-1,3-dithian-2-yl]propanoate (PubChem CID 102245028) has the molecular formula C13H20O6S2 and a molecular weight of 336.43 g/mol. Its IUPAC name is methyl (2S)-2-acetyloxy-3-[2-(2-methoxy-2-oxoethyl)-1,3-dithian-2-yl]propanoate.
| Compound Name | methyl (2S)-2-acetyloxy-3-[2-(2-methoxy-2-oxoethyl)-1,3-dithian-2-yl]propanoate |
|---|---|
| PubChem CID | 102245028 |
| Molecular Formula | C13H20O6S2 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | methyl (2S)-2-acetyloxy-3-[2-(2-methoxy-2-oxoethyl)-1,3-dithian-2-yl]propanoate |
| SMILES | COC(=O)CC1(C[C@H](OC(C)=O)C(=O)OC)SCCCS1 |
| InChI | InChI=1S/C13H20O6S2/c1-9(14)19-10(12(16)18-3)7-13(8-11(15)17-2)20-5-4-6-21-13/h10H,4-8H2,1-3H3/t10-/m0/s1 |
| InChIKey | NPCUEZHEGXGCFE-JTQLQIEISA-N |
| XLogP | 1.61 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|