C14H28O4S2 — CID 142963716
2-methylsulfanylethyl 2-(2-butyl-2,6-dimethyl-1,3,2-dioxathian-4-yl)acetate (PubChem CID 142963716) has the molecular formula C14H28O4S2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 2-methylsulfanylethyl 2-(2-butyl-2,6-dimethyl-1,3,2-dioxathian-4-yl)acetate.
| Compound Name | 2-methylsulfanylethyl 2-(2-butyl-2,6-dimethyl-1,3,2-dioxathian-4-yl)acetate |
|---|---|
| PubChem CID | 142963716 |
| Molecular Formula | C14H28O4S2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-methylsulfanylethyl 2-(2-butyl-2,6-dimethyl-1,3,2-dioxathian-4-yl)acetate |
| SMILES | CCCCS1(C)OC(C)CC(CC(=O)OCCSC)O1 |
| InChI | InChI=1S/C14H28O4S2/c1-5-6-9-20(4)17-12(2)10-13(18-20)11-14(15)16-7-8-19-3/h12-13H,5-11H2,1-4H3 |
| InChIKey | CPVATCWIASFDFQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|