C11H18O4S2 — CID 134894709
[2,2-bis(methylsulfanyl)-1-(2-oxooxan-3-yl)ethyl] acetate (PubChem CID 134894709) has the molecular formula C11H18O4S2 and a molecular weight of 278.39 g/mol. Its IUPAC name is [2,2-bis(methylsulfanyl)-1-(2-oxooxan-3-yl)ethyl] acetate.
| Compound Name | [2,2-bis(methylsulfanyl)-1-(2-oxooxan-3-yl)ethyl] acetate |
|---|---|
| PubChem CID | 134894709 |
| Molecular Formula | C11H18O4S2 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | [2,2-bis(methylsulfanyl)-1-(2-oxooxan-3-yl)ethyl] acetate |
| SMILES | CSC(SC)C(OC(C)=O)C1CCCOC1=O |
| InChI | InChI=1S/C11H18O4S2/c1-7(12)15-9(11(16-2)17-3)8-5-4-6-14-10(8)13/h8-9,11H,4-6H2,1-3H3 |
| InChIKey | IZBJCDBPKSSFME-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|