C9H16O3S2 — CID 101056805
3-[1-hydroxy-2,2-bis(methylsulfanyl)ethyl]oxan-2-one (PubChem CID 101056805) has the molecular formula C9H16O3S2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 3-[1-hydroxy-2,2-bis(methylsulfanyl)ethyl]oxan-2-one.
| Compound Name | 3-[1-hydroxy-2,2-bis(methylsulfanyl)ethyl]oxan-2-one |
|---|---|
| PubChem CID | 101056805 |
| Molecular Formula | C9H16O3S2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 3-[1-hydroxy-2,2-bis(methylsulfanyl)ethyl]oxan-2-one |
| SMILES | CSC(SC)C(O)C1CCCOC1=O |
| InChI | InChI=1S/C9H16O3S2/c1-13-9(14-2)7(10)6-4-3-5-12-8(6)11/h6-7,9-10H,3-5H2,1-2H3 |
| InChIKey | GFGGANPRYXAUNY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|