C8H12O3S — CID 77214931
ethyl 4-hydroxy-2-thiabicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 77214931) has the molecular formula C8H12O3S and a molecular weight of 188.25 g/mol. Its IUPAC name is ethyl 4-hydroxy-2-thiabicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | ethyl 4-hydroxy-2-thiabicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 77214931 |
| Molecular Formula | C8H12O3S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | ethyl 4-hydroxy-2-thiabicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | CCOC(=O)C1C2SCC(O)C21 |
| InChI | InChI=1S/C8H12O3S/c1-2-11-8(10)6-5-4(9)3-12-7(5)6/h4-7,9H,2-3H2,1H3 |
| InChIKey | ZOFMWONIDXBIJK-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |