C8H10O3S — CID 59712938
ethenyl (1R,4S,5S,6S)-4-hydroxy-2-thiabicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 59712938) has the molecular formula C8H10O3S and a molecular weight of 186.23 g/mol. Its IUPAC name is ethenyl (1R,4S,5S,6S)-4-hydroxy-2-thiabicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | ethenyl (1R,4S,5S,6S)-4-hydroxy-2-thiabicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 59712938 |
| Molecular Formula | C8H10O3S |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | ethenyl (1R,4S,5S,6S)-4-hydroxy-2-thiabicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | C=COC(=O)[C@H]1[C@@H]2SC[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C8H10O3S/c1-2-11-8(10)6-5-4(9)3-12-7(5)6/h2,4-7,9H,1,3H2/t4-,5-,6-,7-/m1/s1 |
| InChIKey | VEZOMEABSMTEMK-DBRKOABJSA-N |
| XLogP | 0.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|