C10H16O3S2 — CID 11459322
(4R,6R)-6-(1,3-dithian-2-ylmethyl)-4-hydroxyoxan-2-one (PubChem CID 11459322) has the molecular formula C10H16O3S2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (4R,6R)-6-(1,3-dithian-2-ylmethyl)-4-hydroxyoxan-2-one.
| Compound Name | (4R,6R)-6-(1,3-dithian-2-ylmethyl)-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 11459322 |
| Molecular Formula | C10H16O3S2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | (4R,6R)-6-(1,3-dithian-2-ylmethyl)-4-hydroxyoxan-2-one |
| SMILES | O=C1C[C@H](O)C[C@H](CC2SCCCS2)O1 |
| InChI | InChI=1S/C10H16O3S2/c11-7-4-8(13-9(12)5-7)6-10-14-2-1-3-15-10/h7-8,10-11H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | YHZPNCIYDQFBDA-HTQZYQBOSA-N |
| XLogP | 1.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |