C10H18O3 — CID 101153094
1-[(2R,4R)-4-tert-butyl-1,3-dioxan-2-yl]ethanone (PubChem CID 101153094) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 1-[(2R,4R)-4-tert-butyl-1,3-dioxan-2-yl]ethanone.
| Compound Name | 1-[(2R,4R)-4-tert-butyl-1,3-dioxan-2-yl]ethanone |
|---|---|
| PubChem CID | 101153094 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 1-[(2R,4R)-4-tert-butyl-1,3-dioxan-2-yl]ethanone |
| SMILES | CC(=O)[C@@H]1OCC[C@H](C(C)(C)C)O1 |
| InChI | InChI=1S/C10H18O3/c1-7(11)9-12-6-5-8(13-9)10(2,3)4/h8-9H,5-6H2,1-4H3/t8-,9-/m1/s1 |
| InChIKey | RDAVMNBLVJNABN-RKDXNWHRSA-N |
| XLogP | 1.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |