C13H19NO6 — CID 101155040
[(1R,2R,5R,6R)-5,6-diacetyloxy-2-amino-4-methylcyclohex-3-en-1-yl] acetate (PubChem CID 101155040) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is [(1R,2R,5R,6R)-5,6-diacetyloxy-2-amino-4-methylcyclohex-3-en-1-yl] acetate.
| Compound Name | [(1R,2R,5R,6R)-5,6-diacetyloxy-2-amino-4-methylcyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 101155040 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | [(1R,2R,5R,6R)-5,6-diacetyloxy-2-amino-4-methylcyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@H](OC(C)=O)C(C)=C[C@H]1N |
| InChI | InChI=1S/C13H19NO6/c1-6-5-10(14)12(19-8(3)16)13(20-9(4)17)11(6)18-7(2)15/h5,10-13H,14H2,1-4H3/t10-,11-,12-,13-/m1/s1 |
| InChIKey | KYQRKCJPTGCVEN-FDYHWXHSSA-N |
| XLogP | 0.07 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|