C13H25NO6 — CID 101155050
(1R,4R,5R,6R)-4,5,6-tris(methoxymethoxy)-3-methylcyclohex-2-en-1-amine (PubChem CID 101155050) has the molecular formula C13H25NO6 and a molecular weight of 291.34 g/mol. Its IUPAC name is (1R,4R,5R,6R)-4,5,6-tris(methoxymethoxy)-3-methylcyclohex-2-en-1-amine.
| Compound Name | (1R,4R,5R,6R)-4,5,6-tris(methoxymethoxy)-3-methylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 101155050 |
| Molecular Formula | C13H25NO6 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | (1R,4R,5R,6R)-4,5,6-tris(methoxymethoxy)-3-methylcyclohex-2-en-1-amine |
| SMILES | COCO[C@H]1[C@H](OCOC)[C@H](OCOC)C(C)=C[C@H]1N |
| InChI | InChI=1S/C13H25NO6/c1-9-5-10(14)12(19-7-16-3)13(20-8-17-4)11(9)18-6-15-2/h5,10-13H,6-8,14H2,1-4H3/t10-,11-,12-,13-/m1/s1 |
| InChIKey | ISPPAXCMIHRTQU-FDYHWXHSSA-N |
| XLogP | 0.24 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|