C10H18BrNO4 — CID 102382177
(1R,4R,5S)-2-bromo-4,5-bis(methoxymethoxy)cyclohex-2-en-1-amine (PubChem CID 102382177) has the molecular formula C10H18BrNO4 and a molecular weight of 296.16 g/mol. Its IUPAC name is (1R,4R,5S)-2-bromo-4,5-bis(methoxymethoxy)cyclohex-2-en-1-amine.
| Compound Name | (1R,4R,5S)-2-bromo-4,5-bis(methoxymethoxy)cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 102382177 |
| Molecular Formula | C10H18BrNO4 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | (1R,4R,5S)-2-bromo-4,5-bis(methoxymethoxy)cyclohex-2-en-1-amine |
| SMILES | COCO[C@H]1C[C@@H](N)C(Br)=C[C@H]1OCOC |
| InChI | InChI=1S/C10H18BrNO4/c1-13-5-15-9-3-7(11)8(12)4-10(9)16-6-14-2/h3,8-10H,4-6,12H2,1-2H3/t8-,9-,10+/m1/s1 |
| InChIKey | XZWQRSZECOOODX-BBBLOLIVSA-N |
| XLogP | 0.97 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|