C12H22BrNO6 — CID 102382170
(1R,4R,5R,6R)-2-bromo-4,5,6-tris(methoxymethoxy)cyclohex-2-en-1-amine (PubChem CID 102382170) has the molecular formula C12H22BrNO6 and a molecular weight of 356.21 g/mol. Its IUPAC name is (1R,4R,5R,6R)-2-bromo-4,5,6-tris(methoxymethoxy)cyclohex-2-en-1-amine.
| Compound Name | (1R,4R,5R,6R)-2-bromo-4,5,6-tris(methoxymethoxy)cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 102382170 |
| Molecular Formula | C12H22BrNO6 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (1R,4R,5R,6R)-2-bromo-4,5,6-tris(methoxymethoxy)cyclohex-2-en-1-amine |
| SMILES | COCO[C@H]1[C@H](OCOC)[C@@H](N)C(Br)=C[C@H]1OCOC |
| InChI | InChI=1S/C12H22BrNO6/c1-15-5-18-9-4-8(13)10(14)12(20-7-17-3)11(9)19-6-16-2/h4,9-12H,5-7,14H2,1-3H3/t9-,10+,11-,12-/m1/s1 |
| InChIKey | DPAUWODEOCFPJT-WRWGMCAJSA-N |
| XLogP | 0.57 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|