C13H23N3O6 — CID 101155047
(3R,4S,5S,6S)-3-azido-4,5,6-tris(methoxymethoxy)-1-methylcyclohexene (PubChem CID 101155047) has the molecular formula C13H23N3O6 and a molecular weight of 317.34 g/mol. Its IUPAC name is (3R,4S,5S,6S)-3-azido-4,5,6-tris(methoxymethoxy)-1-methylcyclohexene.
| Compound Name | (3R,4S,5S,6S)-3-azido-4,5,6-tris(methoxymethoxy)-1-methylcyclohexene |
|---|---|
| PubChem CID | 101155047 |
| Molecular Formula | C13H23N3O6 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (3R,4S,5S,6S)-3-azido-4,5,6-tris(methoxymethoxy)-1-methylcyclohexene |
| SMILES | COCO[C@@H]1[C@@H](OCOC)[C@@H](OCOC)C(C)=C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C13H23N3O6/c1-9-5-10(15-16-14)12(21-7-18-3)13(22-8-19-4)11(9)20-6-17-2/h5,10-13H,6-8H2,1-4H3/t10-,11+,12+,13+/m1/s1 |
| InChIKey | QLCNCJGJIAWRFL-VOAKCMCISA-N |
| XLogP | 1.59 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|