C14H23N3O6 — CID 10520383
(3aS,4R,7S,7aS)-7-azido-4-(methoxymethoxy)-5-(methoxymethoxymethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole (PubChem CID 10520383) has the molecular formula C14H23N3O6 and a molecular weight of 329.35 g/mol. Its IUPAC name is (3aS,4R,7S,7aS)-7-azido-4-(methoxymethoxy)-5-(methoxymethoxymethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole.
| Compound Name | (3aS,4R,7S,7aS)-7-azido-4-(methoxymethoxy)-5-(methoxymethoxymethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 10520383 |
| Molecular Formula | C14H23N3O6 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (3aS,4R,7S,7aS)-7-azido-4-(methoxymethoxy)-5-(methoxymethoxymethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole |
| SMILES | COCOCC1=C[C@H](N=[N+]=[N-])[C@@H]2OC(C)(C)O[C@H]2[C@@H]1OCOC |
| InChI | InChI=1S/C14H23N3O6/c1-14(2)22-12-10(16-17-15)5-9(6-20-7-18-3)11(13(12)23-14)21-8-19-4/h5,10-13H,6-8H2,1-4H3/t10-,11+,12-,13-/m0/s1 |
| InChIKey | VPKSNXYRMXNWTF-RNJOBUHISA-N |
| XLogP | 1.74 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|