C15H19N3O8 — CID 14018177
[(3S,4S,5S,6R)-4,5,6-triacetyloxy-3-azidocyclohexen-1-yl]methyl acetate (PubChem CID 14018177) has the molecular formula C15H19N3O8 and a molecular weight of 369.33 g/mol. Its IUPAC name is [(3S,4S,5S,6R)-4,5,6-triacetyloxy-3-azidocyclohexen-1-yl]methyl acetate.
| Compound Name | [(3S,4S,5S,6R)-4,5,6-triacetyloxy-3-azidocyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 14018177 |
| Molecular Formula | C15H19N3O8 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [(3S,4S,5S,6R)-4,5,6-triacetyloxy-3-azidocyclohexen-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C[C@H](N=[N+]=[N-])[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H19N3O8/c1-7(19)23-6-11-5-12(17-18-16)14(25-9(3)21)15(26-10(4)22)13(11)24-8(2)20/h5,12-15H,6H2,1-4H3/t12-,13+,14-,15-/m0/s1 |
| InChIKey | WTNLHGPBVAMDFT-XGUBFFRZSA-N |
| XLogP | 0.96 |
| TPSA | 153.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|