C14H19NO4S — CID 10685422
(3aS,4S,9aR,9bS)-4-isothiocyanato-2,2,8,8-tetramethyl-4,6,9a,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-h][1,3]benzodioxine (PubChem CID 10685422) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is (3aS,4S,9aR,9bS)-4-isothiocyanato-2,2,8,8-tetramethyl-4,6,9a,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-h][1,3]benzodioxine.
| Compound Name | (3aS,4S,9aR,9bS)-4-isothiocyanato-2,2,8,8-tetramethyl-4,6,9a,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-h][1,3]benzodioxine |
|---|---|
| PubChem CID | 10685422 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (3aS,4S,9aR,9bS)-4-isothiocyanato-2,2,8,8-tetramethyl-4,6,9a,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-h][1,3]benzodioxine |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@@H]1OC(C)(C)OCC1=C[C@@H]2N=C=S |
| InChI | InChI=1S/C14H19NO4S/c1-13(2)16-6-8-5-9(15-7-20)11-12(10(8)17-13)19-14(3,4)18-11/h5,9-12H,6H2,1-4H3/t9-,10+,11-,12-/m0/s1 |
| InChIKey | ALSAVXHKFSIUDK-USZNOCQGSA-N |
| XLogP | 2.07 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|