C14H25NO6 — CID 10542463
(3aS,4S,7R,7aS)-7-(methoxymethoxy)-6-(methoxymethoxymethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-amine (PubChem CID 10542463) has the molecular formula C14H25NO6 and a molecular weight of 303.36 g/mol. Its IUPAC name is (3aS,4S,7R,7aS)-7-(methoxymethoxy)-6-(methoxymethoxymethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-amine.
| Compound Name | (3aS,4S,7R,7aS)-7-(methoxymethoxy)-6-(methoxymethoxymethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-amine |
|---|---|
| PubChem CID | 10542463 |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | (3aS,4S,7R,7aS)-7-(methoxymethoxy)-6-(methoxymethoxymethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-amine |
| SMILES | COCOCC1=C[C@H](N)[C@@H]2OC(C)(C)O[C@H]2[C@@H]1OCOC |
| InChI | InChI=1S/C14H25NO6/c1-14(2)20-12-10(15)5-9(6-18-7-16-3)11(13(12)21-14)19-8-17-4/h5,10-13H,6-8,15H2,1-4H3/t10-,11+,12-,13-/m0/s1 |
| InChIKey | ABLACELIZUBIQH-RNJOBUHISA-N |
| XLogP | 0.38 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|