C21H37NO4 — CID 59459603
(3aS,4R,9aS)-2,2,8,8-tetramethyl-N-octyl-4,6,9a,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-h][1,3]benzodioxin-4-amine (PubChem CID 59459603) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is (3aS,4R,9aS)-2,2,8,8-tetramethyl-N-octyl-4,6,9a,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-h][1,3]benzodioxin-4-amine.
| Compound Name | (3aS,4R,9aS)-2,2,8,8-tetramethyl-N-octyl-4,6,9a,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-h][1,3]benzodioxin-4-amine |
|---|---|
| PubChem CID | 59459603 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | (3aS,4R,9aS)-2,2,8,8-tetramethyl-N-octyl-4,6,9a,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-h][1,3]benzodioxin-4-amine |
| SMILES | CCCCCCCCN[C@@H]1C=C2COC(C)(C)O[C@@H]2C2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C21H37NO4/c1-6-7-8-9-10-11-12-22-16-13-15-14-23-20(2,3)24-17(15)19-18(16)25-21(4,5)26-19/h13,16-19,22H,6-12,14H2,1-5H3/t16-,17+,18+,19?/m1/s1 |
| InChIKey | RLSMFOUBFQRHNY-CJPNDHRQSA-N |
| XLogP | 3.92 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|