C26H45NO6 — CID 59459595
tert-butyl N-[(3aS,4R,9aS)-2,2,8,8-tetramethyl-4,6,9a,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-h][1,3]benzodioxin-4-yl]-N-octylcarbamate (PubChem CID 59459595) has the molecular formula C26H45NO6 and a molecular weight of 467.65 g/mol. Its IUPAC name is tert-butyl N-[(3aS,4R,9aS)-2,2,8,8-tetramethyl-4,6,9a,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-h][1,3]benzodioxin-4-yl]-N-octylcarbamate.
| Compound Name | tert-butyl N-[(3aS,4R,9aS)-2,2,8,8-tetramethyl-4,6,9a,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-h][1,3]benzodioxin-4-yl]-N-octylcarbamate |
|---|---|
| PubChem CID | 59459595 |
| Molecular Formula | C26H45NO6 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.32 |
| IUPAC Name | tert-butyl N-[(3aS,4R,9aS)-2,2,8,8-tetramethyl-4,6,9a,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-h][1,3]benzodioxin-4-yl]-N-octylcarbamate |
| SMILES | CCCCCCCCN(C(=O)OC(C)(C)C)[C@@H]1C=C2COC(C)(C)O[C@@H]2C2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C26H45NO6/c1-9-10-11-12-13-14-15-27(23(28)33-24(2,3)4)19-16-18-17-29-25(5,6)30-20(18)22-21(19)31-26(7,8)32-22/h16,19-22H,9-15,17H2,1-8H3/t19-,20+,21+,22?/m1/s1 |
| InChIKey | WZFXKCJLSNQRQM-ZPHWTRHBSA-N |
| XLogP | 5.56 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|